C14H11NO5 — CID 171871244
5-[4-(2-cyano-1,2-dihydroxyethyl)phenyl]furan-2-carboxylic acid (PubChem CID 171871244) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 5-[4-(2-cyano-1,2-dihydroxyethyl)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(2-cyano-1,2-dihydroxyethyl)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 171871244 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-[4-(2-cyano-1,2-dihydroxyethyl)phenyl]furan-2-carboxylic acid |
| SMILES | N#CC(O)C(O)c1ccc(-c2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C14H11NO5/c15-7-10(16)13(17)9-3-1-8(2-4-9)11-5-6-12(20-11)14(18)19/h1-6,10,13,16-17H,(H,18,19) |
| InChIKey | WUWUVRLGGLNRCF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|