C14H14O6 — CID 170818849
5-[4-(1,2,3-trihydroxypropyl)phenyl]furan-2-carboxylic acid (PubChem CID 170818849) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 5-[4-(1,2,3-trihydroxypropyl)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(1,2,3-trihydroxypropyl)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 170818849 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-[4-(1,2,3-trihydroxypropyl)phenyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C(O)C(O)CO)cc2)o1 |
| InChI | InChI=1S/C14H14O6/c15-7-10(16)13(17)9-3-1-8(2-4-9)11-5-6-12(20-11)14(18)19/h1-6,10,13,15-17H,7H2,(H,18,19) |
| InChIKey | MTGLOTFQKMLXOZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |