C16H18O3 — CID 66257827
5-[4-(2-methylbutan-2-yl)phenyl]furan-2-carboxylic acid (PubChem CID 66257827) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-[4-(2-methylbutan-2-yl)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(2-methylbutan-2-yl)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 66257827 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5-[4-(2-methylbutan-2-yl)phenyl]furan-2-carboxylic acid |
| SMILES | CCC(C)(C)c1ccc(-c2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C16H18O3/c1-4-16(2,3)12-7-5-11(6-8-12)13-9-10-14(19-13)15(17)18/h5-10H,4H2,1-3H3,(H,17,18) |
| InChIKey | AKOWWNMASLONQA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |