C14H12O4 — CID 169454193
5-[4-(3-hydroxyprop-1-enyl)phenyl]furan-2-carboxylic acid (PubChem CID 169454193) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-[4-(3-hydroxyprop-1-enyl)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(3-hydroxyprop-1-enyl)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 169454193 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-[4-(3-hydroxyprop-1-enyl)phenyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C=CCO)cc2)o1 |
| InChI | InChI=1S/C14H12O4/c15-9-1-2-10-3-5-11(6-4-10)12-7-8-13(18-12)14(16)17/h1-8,15H,9H2,(H,16,17) |
| InChIKey | LKVOFPNDVKKZNO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |