C10H11NO2 — CID 171869656
2,3-dihydroxy-3-(4-methylphenyl)propanenitrile (PubChem CID 171869656) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-methylphenyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(4-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 171869656 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2,3-dihydroxy-3-(4-methylphenyl)propanenitrile |
| SMILES | Cc1ccc(C(O)C(O)C#N)cc1 |
| InChI | InChI=1S/C10H11NO2/c1-7-2-4-8(5-3-7)10(13)9(12)6-11/h2-5,9-10,12-13H,1H3 |
| InChIKey | LAMKWQABRCNMCB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|