C13H11NO2 — CID 171870416
2,3-dihydroxy-3-naphthalen-2-ylpropanenitrile (PubChem CID 171870416) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2,3-dihydroxy-3-naphthalen-2-ylpropanenitrile.
| Compound Name | 2,3-dihydroxy-3-naphthalen-2-ylpropanenitrile |
|---|---|
| PubChem CID | 171870416 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2,3-dihydroxy-3-naphthalen-2-ylpropanenitrile |
| SMILES | N#CC(O)C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H11NO2/c14-8-12(15)13(16)11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12-13,15-16H |
| InChIKey | HASLIFGOGGEJPA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|