C14H13NO2 — CID 171901152
3,4-dihydroxy-4-naphthalen-2-ylbutanenitrile (PubChem CID 171901152) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3,4-dihydroxy-4-naphthalen-2-ylbutanenitrile.
| Compound Name | 3,4-dihydroxy-4-naphthalen-2-ylbutanenitrile |
|---|---|
| PubChem CID | 171901152 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3,4-dihydroxy-4-naphthalen-2-ylbutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H13NO2/c15-8-7-13(16)14(17)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13-14,16-17H,7H2 |
| InChIKey | BWRZAPINQAUYKR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |