C18H16OS — CID 10802720
(1S,2S)-1-naphthalen-2-yl-2-phenyl-2-sulfanylethanol (PubChem CID 10802720) has the molecular formula C18H16OS and a molecular weight of 280.39 g/mol. Its IUPAC name is (1S,2S)-1-naphthalen-2-yl-2-phenyl-2-sulfanylethanol.
| Compound Name | (1S,2S)-1-naphthalen-2-yl-2-phenyl-2-sulfanylethanol |
|---|---|
| PubChem CID | 10802720 |
| Molecular Formula | C18H16OS |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1S,2S)-1-naphthalen-2-yl-2-phenyl-2-sulfanylethanol |
| SMILES | O[C@@H](c1ccc2ccccc2c1)[C@@H](S)c1ccccc1 |
| InChI | InChI=1S/C18H16OS/c19-17(18(20)14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12,17-20H/t17-,18-/m0/s1 |
| InChIKey | XNRWHNPIVLYFFK-ROUUACIJSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|