C21H23NO — CID 10709738
(1S,2S)-1-naphthalen-2-yl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol (PubChem CID 10709738) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (1S,2S)-1-naphthalen-2-yl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol.
| Compound Name | (1S,2S)-1-naphthalen-2-yl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 10709738 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (1S,2S)-1-naphthalen-2-yl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol |
| SMILES | C[C@H](N[C@H](C)c1ccccc1)[C@@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H23NO/c1-15(17-8-4-3-5-9-17)22-16(2)21(23)20-13-12-18-10-6-7-11-19(18)14-20/h3-16,21-23H,1-2H3/t15-,16+,21-/m1/s1 |
| InChIKey | QZKFERBUDWVDKI-VWKPWSFCSA-N |
| XLogP | 4.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |