C9H11N3O2 — CID 171869910
3-(4-hydrazinylphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869910) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-(4-hydrazinylphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(4-hydrazinylphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869910 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-(4-hydrazinylphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(NN)cc1 |
| InChI | InChI=1S/C9H11N3O2/c10-5-8(13)9(14)6-1-3-7(12-11)4-2-6/h1-4,8-9,12-14H,11H2 |
| InChIKey | BTNBHHSAYNDDTK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|