4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid

C14H20O4 — CID 79414012

IUPAC4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid
SMILESCOCc1ccc(C(O)C(C)C(C)C(=O)O)cc1
InChIInChI=1S/C14H20O4/c1-9(10(2)14(16)17)13(15)12-6-4-11(5-7-12)8-18-3/h4-7,9-10,13,15H,8H2,1-3H3,(H,16,17)
InChIKeyHEUXFDWVDAKKPW-UHFFFAOYSA-N
MW252.31 g/mol
LogP2.22
Rot. Bonds6

About 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid

4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid (PubChem CID 79414012) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid.

Molecular Properties

Compound Name4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid
PubChem CID79414012
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Name4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid
SMILESCOCc1ccc(C(O)C(C)C(C)C(=O)O)cc1
InChIInChI=1S/C14H20O4/c1-9(10(2)14(16)17)13(15)12-6-4-11(5-7-12)8-18-3/h4-7,9-10,13,15H,8H2,1-3H3,(H,16,17)
InChIKeyHEUXFDWVDAKKPW-UHFFFAOYSA-N
XLogP2.22
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 52.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid?
The IUPAC name of 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid (CID 79414012) is 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid.
What is the SMILES notation for 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid?
The canonical SMILES for 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid is COCc1ccc(C(O)C(C)C(C)C(=O)O)cc1.
What is the InChIKey of 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid?
The InChIKey is HEUXFDWVDAKKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-9(10(2)14(16)17)13(15)12-6-4-11(5-7-12)8-18-3/h4-7,9-10,13,15H,8H2,1-3H3,(H,16,17).
What are the key properties of 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid?
4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid has a molecular weight of 252.31 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-4-[4-(methoxymethyl)phenyl]-2,3-dimethylbutanoic acid is sourced from PubChem (CID 79414012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).