C11H14O5 — CID 170823892
2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanoic acid (PubChem CID 170823892) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanoic acid.
| Compound Name | 2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170823892 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,3-dihydroxy-3-[4-(methoxymethyl)phenyl]propanoic acid |
| SMILES | COCc1ccc(C(O)C(O)C(=O)O)cc1 |
| InChI | InChI=1S/C11H14O5/c1-16-6-7-2-4-8(5-3-7)9(12)10(13)11(14)15/h2-5,9-10,12-13H,6H2,1H3,(H,14,15) |
| InChIKey | XRQRRTNKZRPRPN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |