C16H16F2O2 — CID 105402605
2-(3,5-difluorophenyl)-1-[4-(methoxymethyl)phenyl]ethanol (PubChem CID 105402605) has the molecular formula C16H16F2O2 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-[4-(methoxymethyl)phenyl]ethanol.
| Compound Name | 2-(3,5-difluorophenyl)-1-[4-(methoxymethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 105402605 |
| Molecular Formula | C16H16F2O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-[4-(methoxymethyl)phenyl]ethanol |
| SMILES | COCc1ccc(C(O)Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H16F2O2/c1-20-10-11-2-4-13(5-3-11)16(19)8-12-6-14(17)9-15(18)7-12/h2-7,9,16,19H,8,10H2,1H3 |
| InChIKey | GFERKNHVCIZXQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |