C12H15FO3 — CID 79414690
4-(4-fluorophenyl)-4-hydroxy-2,3-dimethylbutanoic acid (PubChem CID 79414690) has the molecular formula C12H15FO3 and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-4-hydroxy-2,3-dimethylbutanoic acid.
| Compound Name | 4-(4-fluorophenyl)-4-hydroxy-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 79414690 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(4-fluorophenyl)-4-hydroxy-2,3-dimethylbutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FO3/c1-7(8(2)12(15)16)11(14)9-3-5-10(13)6-4-9/h3-8,11,14H,1-2H3,(H,15,16) |
| InChIKey | YIZYWRNCBIBRPQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |