C13H18N2O3 — CID 171871163
3-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydroxypropanenitrile (PubChem CID 171871163) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydroxypropanenitrile.
| Compound Name | 3-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871163 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydroxypropanenitrile |
| SMILES | CN(C)CCOc1ccc(C(O)C(O)C#N)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-15(2)7-8-18-11-5-3-10(4-6-11)13(17)12(16)9-14/h3-6,12-13,16-17H,7-8H2,1-2H3 |
| InChIKey | ZPTFDTCAMGZIHU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|