C19H23NO — CID 143961107
N,N-dimethyl-2-[4-(1-phenylprop-2-enyl)phenoxy]ethanamine (PubChem CID 143961107) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(1-phenylprop-2-enyl)phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-(1-phenylprop-2-enyl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 143961107 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N,N-dimethyl-2-[4-(1-phenylprop-2-enyl)phenoxy]ethanamine |
| SMILES | C=CC(c1ccccc1)c1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C19H23NO/c1-4-19(16-8-6-5-7-9-16)17-10-12-18(13-11-17)21-15-14-20(2)3/h4-13,19H,1,14-15H2,2-3H3 |
| InChIKey | OGRKNCVMEFTVGT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|