C11H16N2O — CID 175999617
2-[(6-ethenyl-3-pyridinyl)oxy]-N,N-dimethylethanamine (PubChem CID 175999617) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(6-ethenyl-3-pyridinyl)oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(6-ethenyl-3-pyridinyl)oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 175999617 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[(6-ethenyl-3-pyridinyl)oxy]-N,N-dimethylethanamine |
| SMILES | C=Cc1ccc(OCCN(C)C)cn1 |
| InChI | InChI=1S/C11H16N2O/c1-4-10-5-6-11(9-12-10)14-8-7-13(2)3/h4-6,9H,1,7-8H2,2-3H3 |
| InChIKey | BIZJWPHVVRMAKN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |