C21H27N3O2 — CID 20553504
2-[6-[2-(dimethylamino)ethoxy]acridin-3-yl]oxy-N,N-dimethylethanamine (PubChem CID 20553504) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[6-[2-(dimethylamino)ethoxy]acridin-3-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[6-[2-(dimethylamino)ethoxy]acridin-3-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 20553504 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-[6-[2-(dimethylamino)ethoxy]acridin-3-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc2cc3ccc(OCCN(C)C)cc3nc2c1 |
| InChI | InChI=1S/C21H27N3O2/c1-23(2)9-11-25-18-7-5-16-13-17-6-8-19(26-12-10-24(3)4)15-21(17)22-20(16)14-18/h5-8,13-15H,9-12H2,1-4H3 |
| InChIKey | IJEGQPCVVCTYCG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|