C25H36ClN3O2Zn — CID 88751722
2-[6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine;zinc;hydrochloride (PubChem CID 88751722) has the molecular formula C25H36ClN3O2Zn and a molecular weight of 511.43 g/mol. Its IUPAC name is 2-[6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine;zinc;hydrochloride.
| Compound Name | 2-[6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine;zinc;hydrochloride |
|---|---|
| PubChem CID | 88751722 |
| Molecular Formula | C25H36ClN3O2Zn |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 2-[6-[2-(diethylamino)ethoxy]acridin-3-yl]oxy-N,N-diethylethanamine;zinc;hydrochloride |
| SMILES | CCN(CC)CCOc1ccc2cc3ccc(OCCN(CC)CC)cc3nc2c1.Cl.[Zn] |
| InChI | InChI=1S/C25H35N3O2.ClH.Zn/c1-5-27(6-2)13-15-29-22-11-9-20-17-21-10-12-23(19-25(21)26-24(20)18-22)30-16-14-28(7-3)8-4;;/h9-12,17-19H,5-8,13-16H2,1-4H3;1H; |
| InChIKey | UGEPVHTZPHTSJG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|