C21H30ClN3O3 — CID 45260080
N-methyl-3-[6-[3-(methylamino)propoxy]acridin-3-yl]oxypropan-1-amine;hydrate;hydrochloride (PubChem CID 45260080) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is N-methyl-3-[6-[3-(methylamino)propoxy]acridin-3-yl]oxypropan-1-amine;hydrate;hydrochloride.
| Compound Name | N-methyl-3-[6-[3-(methylamino)propoxy]acridin-3-yl]oxypropan-1-amine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 45260080 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-methyl-3-[6-[3-(methylamino)propoxy]acridin-3-yl]oxypropan-1-amine;hydrate;hydrochloride |
| SMILES | CNCCCOc1ccc2cc3ccc(OCCCNC)cc3nc2c1.Cl.O |
| InChI | InChI=1S/C21H27N3O2.ClH.H2O/c1-22-9-3-11-25-18-7-5-16-13-17-6-8-19(26-12-4-10-23-2)15-21(17)24-20(16)14-18;;/h5-8,13-15,22-23H,3-4,9-12H2,1-2H3;1H;1H2 |
| InChIKey | BWRKKGQCCNPTJX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|