C13H17ClN2OS — CID 15817632
2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]-N,N-diethylethanamine (PubChem CID 15817632) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]-N,N-diethylethanamine.
| Compound Name | 2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 15817632 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[(2-chloro-1,3-benzothiazol-6-yl)oxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C13H17ClN2OS/c1-3-16(4-2)7-8-17-10-5-6-11-12(9-10)18-13(14)15-11/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | ZMLZRALWAOZDNI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |