C17H23ClN2O3S — CID 171844114
tert-butyl N-[5-[(2-chloro-1,3-benzothiazol-6-yl)oxy]pentyl]carbamate (PubChem CID 171844114) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-chloro-1,3-benzothiazol-6-yl)oxy]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-chloro-1,3-benzothiazol-6-yl)oxy]pentyl]carbamate |
|---|---|
| PubChem CID | 171844114 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | tert-butyl N-[5-[(2-chloro-1,3-benzothiazol-6-yl)oxy]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCOc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C17H23ClN2O3S/c1-17(2,3)23-16(21)19-9-5-4-6-10-22-12-7-8-13-14(11-12)24-15(18)20-13/h7-8,11H,4-6,9-10H2,1-3H3,(H,19,21) |
| InChIKey | WLNFOYLNARVKDB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|