C20H27ClN2O5S — CID 157247270
tert-butyl 4-[2-[2-[(2-chloro-1,3-benzothiazole-6-carbonyl)amino]ethoxy]ethoxy]butanoate (PubChem CID 157247270) has the molecular formula C20H27ClN2O5S and a molecular weight of 442.97 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[(2-chloro-1,3-benzothiazole-6-carbonyl)amino]ethoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[2-[(2-chloro-1,3-benzothiazole-6-carbonyl)amino]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 157247270 |
| Molecular Formula | C20H27ClN2O5S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | tert-butyl 4-[2-[2-[(2-chloro-1,3-benzothiazole-6-carbonyl)amino]ethoxy]ethoxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCOCCNC(=O)c1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C20H27ClN2O5S/c1-20(2,3)28-17(24)5-4-9-26-11-12-27-10-8-22-18(25)14-6-7-15-16(13-14)29-19(21)23-15/h6-7,13H,4-5,8-12H2,1-3H3,(H,22,25) |
| InChIKey | TZXOPPKVADOBOL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|