C21H22ClN5O3S — CID 87360622
2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-[2-(2-methoxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 87360622) has the molecular formula C21H22ClN5O3S and a molecular weight of 459.96 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-[2-(2-methoxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-[2-(2-methoxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 87360622 |
| Molecular Formula | C21H22ClN5O3S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-[2-(2-methoxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | COCCOCCNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(Cl)cc3s1)n2C |
| InChI | InChI=1S/C21H22ClN5O3S/c1-27-17-6-3-13(19(28)23-7-8-30-10-9-29-2)11-16(17)24-20(27)26-21-25-15-5-4-14(22)12-18(15)31-21/h3-6,11-12H,7-10H2,1-2H3,(H,23,28)(H,24,25,26) |
| InChIKey | XYTLDGJKTPSJJT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|