C21H21ClN4O3S — CID 58397420
1-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-(2-hydroxyethoxy)butan-1-one (PubChem CID 58397420) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is 1-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-(2-hydroxyethoxy)butan-1-one.
| Compound Name | 1-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-(2-hydroxyethoxy)butan-1-one |
|---|---|
| PubChem CID | 58397420 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-(2-hydroxyethoxy)butan-1-one |
| SMILES | Cn1c(Nc2nc3ccc(Cl)cc3s2)nc2cc(C(=O)CCCOCCO)ccc21 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-26-17-7-4-13(18(28)3-2-9-29-10-8-27)11-16(17)23-20(26)25-21-24-15-6-5-14(22)12-19(15)30-21/h4-7,11-12,27H,2-3,8-10H2,1H3,(H,23,24,25) |
| InChIKey | KNEBEZRBKFGBGB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|