C22H22F3N5O3S — CID 58397714
4-(2-aminoethoxy)-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one (PubChem CID 58397714) has the molecular formula C22H22F3N5O3S and a molecular weight of 493.51 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one.
| Compound Name | 4-(2-aminoethoxy)-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 58397714 |
| Molecular Formula | C22H22F3N5O3S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 4-(2-aminoethoxy)-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
| SMILES | Cn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)CCCOCCN)ccc21 |
| InChI | InChI=1S/C22H22F3N5O3S/c1-30-17-7-4-13(18(31)3-2-9-32-10-8-26)11-16(17)27-20(30)29-21-28-15-6-5-14(12-19(15)34-21)33-22(23,24)25/h4-7,11-12H,2-3,8-10,26H2,1H3,(H,27,28,29) |
| InChIKey | HDQIGBNZBQNDKB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|