C22H21F3N4O2S2 — CID 58397457
4-ethylsulfanyl-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one (PubChem CID 58397457) has the molecular formula C22H21F3N4O2S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 4-ethylsulfanyl-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one.
| Compound Name | 4-ethylsulfanyl-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 58397457 |
| Molecular Formula | C22H21F3N4O2S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 4-ethylsulfanyl-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
| SMILES | CCSCCCC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C |
| InChI | InChI=1S/C22H21F3N4O2S2/c1-3-32-10-4-5-18(30)13-6-9-17-16(11-13)26-20(29(17)2)28-21-27-15-8-7-14(12-19(15)33-21)31-22(23,24)25/h6-9,11-12H,3-5,10H2,1-2H3,(H,26,27,28) |
| InChIKey | IWBBPDLGROWTBR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|