C19H19ClN4O2S — CID 100787369
2-chloro-N-[3-[4-(dimethylamino)anilino]-3-oxopropyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 100787369) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(dimethylamino)anilino]-3-oxopropyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-chloro-N-[3-[4-(dimethylamino)anilino]-3-oxopropyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 100787369 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-chloro-N-[3-[4-(dimethylamino)anilino]-3-oxopropyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)CCNC(=O)c2ccc3nc(Cl)sc3c2)cc1 |
| InChI | InChI=1S/C19H19ClN4O2S/c1-24(2)14-6-4-13(5-7-14)22-17(25)9-10-21-18(26)12-3-8-15-16(11-12)27-19(20)23-15/h3-8,11H,9-10H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | CNRGNCKFOFAHMM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|