C19H16Cl3N3O2S — CID 24728645
N'-tert-butyl-2-chloro-N'-(3,5-dichlorobenzoyl)-1,3-benzothiazole-6-carbohydrazide (PubChem CID 24728645) has the molecular formula C19H16Cl3N3O2S and a molecular weight of 456.78 g/mol. Its IUPAC name is N'-tert-butyl-2-chloro-N'-(3,5-dichlorobenzoyl)-1,3-benzothiazole-6-carbohydrazide.
| Compound Name | N'-tert-butyl-2-chloro-N'-(3,5-dichlorobenzoyl)-1,3-benzothiazole-6-carbohydrazide |
|---|---|
| PubChem CID | 24728645 |
| Molecular Formula | C19H16Cl3N3O2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | N'-tert-butyl-2-chloro-N'-(3,5-dichlorobenzoyl)-1,3-benzothiazole-6-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc2nc(Cl)sc2c1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl3N3O2S/c1-19(2,3)25(17(27)11-6-12(20)9-13(21)7-11)24-16(26)10-4-5-14-15(8-10)28-18(22)23-14/h4-9H,1-3H3,(H,24,26) |
| InChIKey | CPVYEPYCNVJEPP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|