C16H16Cl2N2O3 — CID 23200652
N-tert-butyl-N'-(3,4-dichlorobenzoyl)furan-3-carbohydrazide (PubChem CID 23200652) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is N-tert-butyl-N'-(3,4-dichlorobenzoyl)furan-3-carbohydrazide.
| Compound Name | N-tert-butyl-N'-(3,4-dichlorobenzoyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 23200652 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-tert-butyl-N'-(3,4-dichlorobenzoyl)furan-3-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1ccoc1 |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-16(2,3)20(15(22)11-6-7-23-9-11)19-14(21)10-4-5-12(17)13(18)8-10/h4-9H,1-3H3,(H,19,21) |
| InChIKey | BOGOIWFRMUMGLB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|