C18H17Cl3N2O2 — CID 23164437
N'-tert-butyl-3,5-dichloro-N'-(4-chlorobenzoyl)benzohydrazide (PubChem CID 23164437) has the molecular formula C18H17Cl3N2O2 and a molecular weight of 399.71 g/mol. Its IUPAC name is N'-tert-butyl-3,5-dichloro-N'-(4-chlorobenzoyl)benzohydrazide.
| Compound Name | N'-tert-butyl-3,5-dichloro-N'-(4-chlorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 23164437 |
| Molecular Formula | C18H17Cl3N2O2 |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | N'-tert-butyl-3,5-dichloro-N'-(4-chlorobenzoyl)benzohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17Cl3N2O2/c1-18(2,3)23(17(25)11-4-6-13(19)7-5-11)22-16(24)12-8-14(20)10-15(21)9-12/h4-10H,1-3H3,(H,22,24) |
| InChIKey | TZIFARHARSLLFI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|