C20H22Cl2N2O2 — CID 70427775
N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,3-dimethylbenzohydrazide (PubChem CID 70427775) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,3-dimethylbenzohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,3-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 70427775 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,3-dimethylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)NN(C(=O)c2cc(Cl)cc(Cl)c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-12-7-6-8-17(13(12)2)18(25)23-24(20(3,4)5)19(26)14-9-15(21)11-16(22)10-14/h6-11H,1-5H3,(H,23,25) |
| InChIKey | PLCNEBYNFBOSFN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|