C23H26Cl2N2O3 — CID 42597330
N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,2,4-trimethyl-3H-1-benzofuran-5-carbohydrazide (PubChem CID 42597330) has the molecular formula C23H26Cl2N2O3 and a molecular weight of 449.38 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,2,4-trimethyl-3H-1-benzofuran-5-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,2,4-trimethyl-3H-1-benzofuran-5-carbohydrazide |
|---|---|
| PubChem CID | 42597330 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dichlorobenzoyl)-2,2,4-trimethyl-3H-1-benzofuran-5-carbohydrazide |
| SMILES | Cc1c(C(=O)NN(C(=O)c2cc(Cl)cc(Cl)c2)C(C)(C)C)ccc2c1CC(C)(C)O2 |
| InChI | InChI=1S/C23H26Cl2N2O3/c1-13-17(7-8-19-18(13)12-23(5,6)30-19)20(28)26-27(22(2,3)4)21(29)14-9-15(24)11-16(25)10-14/h7-11H,12H2,1-6H3,(H,26,28) |
| InChIKey | DXZHWKWOLWPQMV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|