C20H23ClN2O2 — CID 118974776
N-tert-butyl-N'-(2-chlorobenzoyl)-3,5-dimethylbenzohydrazide (PubChem CID 118974776) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-tert-butyl-N'-(2-chlorobenzoyl)-3,5-dimethylbenzohydrazide.
| Compound Name | N-tert-butyl-N'-(2-chlorobenzoyl)-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 118974776 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-tert-butyl-N'-(2-chlorobenzoyl)-3,5-dimethylbenzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccccc2Cl)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-13-10-14(2)12-15(11-13)19(25)23(20(3,4)5)22-18(24)16-8-6-7-9-17(16)21/h6-12H,1-5H3,(H,22,24) |
| InChIKey | SZMJYTDDIMWTCL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|