C21H24N2O4 — CID 50940762
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1,3-benzodioxole-4-carbohydrazide (PubChem CID 50940762) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1,3-benzodioxole-4-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1,3-benzodioxole-4-carbohydrazide |
|---|---|
| PubChem CID | 50940762 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1,3-benzodioxole-4-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2cccc3c2OCO3)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-13-9-14(2)11-15(10-13)20(25)23(21(3,4)5)22-19(24)16-7-6-8-17-18(16)27-12-26-17/h6-11H,12H2,1-5H3,(H,22,24) |
| InChIKey | LNWOMPGTGUMBSU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|