C22H25ClN2O4 — CID 69294857
N'-tert-butyl-5-chloro-N'-(3,5-dimethylbenzoyl)-4H-1,3-benzodioxine-6-carbohydrazide (PubChem CID 69294857) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is N'-tert-butyl-5-chloro-N'-(3,5-dimethylbenzoyl)-4H-1,3-benzodioxine-6-carbohydrazide.
| Compound Name | N'-tert-butyl-5-chloro-N'-(3,5-dimethylbenzoyl)-4H-1,3-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 69294857 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N'-tert-butyl-5-chloro-N'-(3,5-dimethylbenzoyl)-4H-1,3-benzodioxine-6-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2Cl)COCO3)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H25ClN2O4/c1-13-8-14(2)10-15(9-13)21(27)25(22(3,4)5)24-20(26)16-6-7-18-17(19(16)23)11-28-12-29-18/h6-10H,11-12H2,1-5H3,(H,24,26) |
| InChIKey | DRMGFIUELZOMFF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|