C21H24BFN2O4 — CID 90442157
N'-tert-butyl-4-fluoro-1-hydroxy-N'-[3-methyl-5-(trideuteriomethyl)benzoyl]-3H-2,1-benzoxaborole-5-carbohydrazide (PubChem CID 90442157) has the molecular formula C21H24BFN2O4 and a molecular weight of 401.26 g/mol. Its IUPAC name is N'-tert-butyl-4-fluoro-1-hydroxy-N'-[3-methyl-5-(trideuteriomethyl)benzoyl]-3H-2,1-benzoxaborole-5-carbohydrazide.
| Compound Name | N'-tert-butyl-4-fluoro-1-hydroxy-N'-[3-methyl-5-(trideuteriomethyl)benzoyl]-3H-2,1-benzoxaborole-5-carbohydrazide |
|---|---|
| PubChem CID | 90442157 |
| Molecular Formula | C21H24BFN2O4 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N'-tert-butyl-4-fluoro-1-hydroxy-N'-[3-methyl-5-(trideuteriomethyl)benzoyl]-3H-2,1-benzoxaborole-5-carbohydrazide |
| SMILES | [2H]C([2H])([2H])c1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2F)COB3O)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H24BFN2O4/c1-12-8-13(2)10-14(9-12)20(27)25(21(3,4)5)24-19(26)15-6-7-17-16(18(15)23)11-29-22(17)28/h6-10,28H,11H2,1-5H3,(H,24,26)/i1D3 |
| InChIKey | SPJKYVIRCJOWOR-FIBGUPNXSA-N |
| XLogP | 2.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|