C21H25BN2O3 — CID 145046599
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-7-hydroxy-7-borabicyclo[4.2.0]octa-1(6),2,4-triene-4-carbohydrazide (PubChem CID 145046599) has the molecular formula C21H25BN2O3 and a molecular weight of 364.25 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-7-hydroxy-7-borabicyclo[4.2.0]octa-1(6),2,4-triene-4-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-7-hydroxy-7-borabicyclo[4.2.0]octa-1(6),2,4-triene-4-carbohydrazide |
|---|---|
| PubChem CID | 145046599 |
| Molecular Formula | C21H25BN2O3 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-7-hydroxy-7-borabicyclo[4.2.0]octa-1(6),2,4-triene-4-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2)B(O)C3)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H25BN2O3/c1-13-8-14(2)10-17(9-13)20(26)24(21(3,4)5)23-19(25)15-6-7-16-12-22(27)18(16)11-15/h6-11,27H,12H2,1-5H3,(H,23,25) |
| InChIKey | FQGUOAWDEFPHPB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|