C26H34BFN2O4 — CID 90442205
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (PubChem CID 90442205) has the molecular formula C26H34BFN2O4 and a molecular weight of 468.38 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 90442205 |
| Molecular Formula | C26H34BFN2O4 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H34BFN2O4/c1-16-12-17(2)14-19(13-16)23(32)30(24(3,4)5)29-22(31)18-10-11-20(21(28)15-18)27-33-25(6,7)26(8,9)34-27/h10-15H,1-9H3,(H,29,31) |
| InChIKey | XDTPGPOZXQRHMX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|