C29H40BN3O6 — CID 140707572
N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (PubChem CID 140707572) has the molecular formula C29H40BN3O6 and a molecular weight of 537.47 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 140707572 |
| Molecular Formula | C29H40BN3O6 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| SMILES | CC[C@@H](N(NC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c([N+](=O)[O-])c1)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C29H40BN3O6/c1-11-24(27(4,5)6)32(26(35)21-15-18(2)14-19(3)16-21)31-25(34)20-12-13-22(23(17-20)33(36)37)30-38-28(7,8)29(9,10)39-30/h12-17,24H,11H2,1-10H3,(H,31,34)/t24-/m1/s1 |
| InChIKey | WHMKAQUSKSEKLC-XMMPIXPASA-N |
| XLogP | 5.12 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|