C24H31BN2O5 — CID 131746824
[4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-2-formylphenyl]boronic acid (PubChem CID 131746824) has the molecular formula C24H31BN2O5 and a molecular weight of 438.33 g/mol. Its IUPAC name is [4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 131746824 |
| Molecular Formula | C24H31BN2O5 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-2-formylphenyl]boronic acid |
| SMILES | CC[C@@H](N(NC(=O)c1ccc(B(O)O)c(C=O)c1)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H31BN2O5/c1-7-21(24(4,5)6)27(23(30)18-11-15(2)10-16(3)12-18)26-22(29)17-8-9-20(25(31)32)19(13-17)14-28/h8-14,21,31-32H,7H2,1-6H3,(H,26,29)/t21-/m1/s1 |
| InChIKey | QMUYEVFHBOOQOY-OAQYLSRUSA-N |
| XLogP | 2.41 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|