C26H36N2O3 — CID 66764183
N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-2-ethyl-3-methoxybenzohydrazide (PubChem CID 66764183) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-2-ethyl-3-methoxybenzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-2-ethyl-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 66764183 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-2-ethyl-3-methoxybenzohydrazide |
| SMILES | CCc1c(OC)cccc1C(=O)NN(C(=O)c1cc(C)cc(C)c1)C(CC)C(C)(C)C |
| InChI | InChI=1S/C26H36N2O3/c1-9-20-21(12-11-13-22(20)31-8)24(29)27-28(23(10-2)26(5,6)7)25(30)19-15-17(3)14-18(4)16-19/h11-16,23H,9-10H2,1-8H3,(H,27,29) |
| InChIKey | NAZYLRUKLMSVLL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|