C48H64N4O6 — CID 161082110
N'-(3,5-dimethylbenzoyl)-N'-(3,3-dimethylbutan-2-yl)-3-methoxy-2-methylbenzohydrazide;N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-2-ethyl-3-methoxybenzohydrazide (PubChem CID 161082110) has the molecular formula C48H64N4O6 and a molecular weight of 793.06 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-(3,3-dimethylbutan-2-yl)-3-methoxy-2-methylbenzohydrazide;N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-2-ethyl-3-methoxybenzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-(3,3-dimethylbutan-2-yl)-3-methoxy-2-methylbenzohydrazide;N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-2-ethyl-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 161082110 |
| Molecular Formula | C48H64N4O6 |
| Molecular Weight | 793.06 g/mol |
| Exact Mass | 792.48 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-(3,3-dimethylbutan-2-yl)-3-methoxy-2-methylbenzohydrazide;N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpropyl)-2-ethyl-3-methoxybenzohydrazide |
| SMILES | CCc1c(OC)cccc1C(=O)NN(CC(C)(C)C)C(=O)c1cc(C)cc(C)c1.COc1cccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)C(C)(C)C)c1C |
| InChI | InChI=1S/2C24H32N2O3/c1-15-12-16(2)14-19(13-15)23(28)26(18(4)24(5,6)7)25-22(27)20-10-9-11-21(29-8)17(20)3;1-8-19-20(10-9-11-21(19)29-7)22(27)25-26(15-24(4,5)6)23(28)18-13-16(2)12-17(3)14-18/h9-14,18H,1-8H3,(H,25,27);9-14H,8,15H2,1-7H3,(H,25,27) |
| InChIKey | UGAVWRTZDYKPKC-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.06 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|