C25H31N5O5 — CID 77399976
N'-[[3-[tert-butyl-[(2-ethyl-3-methoxybenzoyl)amino]carbamoyl]-5-methylphenyl]methylideneamino]oxamide (PubChem CID 77399976) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is N'-[[3-[tert-butyl-[(2-ethyl-3-methoxybenzoyl)amino]carbamoyl]-5-methylphenyl]methylideneamino]oxamide.
| Compound Name | N'-[[3-[tert-butyl-[(2-ethyl-3-methoxybenzoyl)amino]carbamoyl]-5-methylphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 77399976 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N'-[[3-[tert-butyl-[(2-ethyl-3-methoxybenzoyl)amino]carbamoyl]-5-methylphenyl]methylideneamino]oxamide |
| SMILES | CCc1c(OC)cccc1C(=O)NN(C(=O)c1cc(C)cc(C=NNC(=O)C(N)=O)c1)C(C)(C)C |
| InChI | InChI=1S/C25H31N5O5/c1-7-18-19(9-8-10-20(18)35-6)22(32)29-30(25(3,4)5)24(34)17-12-15(2)11-16(13-17)14-27-28-23(33)21(26)31/h8-14H,7H2,1-6H3,(H2,26,31)(H,28,33)(H,29,32) |
| InChIKey | XHFUAYGYBFDAIY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|