C24H29N3O5 — CID 69298525
N-(2-cyanopropan-2-yl)-N'-(2-ethyl-3-methoxybenzoyl)-3,5-dimethoxy-4-methylbenzohydrazide (PubChem CID 69298525) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-N'-(2-ethyl-3-methoxybenzoyl)-3,5-dimethoxy-4-methylbenzohydrazide.
| Compound Name | N-(2-cyanopropan-2-yl)-N'-(2-ethyl-3-methoxybenzoyl)-3,5-dimethoxy-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 69298525 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-N'-(2-ethyl-3-methoxybenzoyl)-3,5-dimethoxy-4-methylbenzohydrazide |
| SMILES | CCc1c(OC)cccc1C(=O)NN(C(=O)c1cc(OC)c(C)c(OC)c1)C(C)(C)C#N |
| InChI | InChI=1S/C24H29N3O5/c1-8-17-18(10-9-11-19(17)30-5)22(28)26-27(24(3,4)14-25)23(29)16-12-20(31-6)15(2)21(13-16)32-7/h9-13H,8H2,1-7H3,(H,26,28) |
| InChIKey | RMVYIFAOADLMKE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|