C24H27N3O6 — CID 122552951
N-(2-cyanopropan-2-yl)-N'-(3,5-dimethoxy-4-methylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 122552951) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-N'-(3,5-dimethoxy-4-methylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N-(2-cyanopropan-2-yl)-N'-(3,5-dimethoxy-4-methylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 122552951 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-N'-(3,5-dimethoxy-4-methylbenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | COc1cc(C(=O)NN(C(=O)c2ccc3c(c2C)OCCO3)C(C)(C)C#N)cc(OC)c1C |
| InChI | InChI=1S/C24H27N3O6/c1-14-17(7-8-18-21(14)33-10-9-32-18)23(29)27(24(3,4)13-25)26-22(28)16-11-19(30-5)15(2)20(12-16)31-6/h7-8,11-12H,9-10H2,1-6H3,(H,26,28) |
| InChIKey | LKSGKVHTBDBJSW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|