C24H32N2O4 — CID 59838665
N'-(3,5-dimethylbenzoyl)-2-ethyl-3-methoxy-N'-(1-methoxy-2-methylpropan-2-yl)benzohydrazide (PubChem CID 59838665) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-2-ethyl-3-methoxy-N'-(1-methoxy-2-methylpropan-2-yl)benzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-2-ethyl-3-methoxy-N'-(1-methoxy-2-methylpropan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 59838665 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-2-ethyl-3-methoxy-N'-(1-methoxy-2-methylpropan-2-yl)benzohydrazide |
| SMILES | CCc1c(OC)cccc1C(=O)NN(C(=O)c1cc(C)cc(C)c1)C(C)(C)COC |
| InChI | InChI=1S/C24H32N2O4/c1-8-19-20(10-9-11-21(19)30-7)22(27)25-26(24(4,5)15-29-6)23(28)18-13-16(2)12-17(3)14-18/h9-14H,8,15H2,1-7H3,(H,25,27) |
| InChIKey | FWMRARQIZPXGTK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|