C27H38N2O3 — CID 89457066
N-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide (PubChem CID 89457066) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is N-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide.
| Compound Name | N-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 89457066 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | N-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-ethyl-3-methoxybenzohydrazide |
| SMILES | CCC[C@@H](NN(C(=O)c1cc(C)cc(C)c1)C(=O)c1cccc(OC)c1CC)C(C)(C)C |
| InChI | InChI=1S/C27H38N2O3/c1-9-12-24(27(5,6)7)28-29(25(30)20-16-18(3)15-19(4)17-20)26(31)22-13-11-14-23(32-8)21(22)10-2/h11,13-17,24,28H,9-10,12H2,1-8H3/t24-/m1/s1 |
| InChIKey | HNGVTAYIZNQQNU-XMMPIXPASA-N |
| XLogP | 5.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|