C25H34N2O3 — CID 174925580
N'-(3,5-dimethylbenzoyl)-N-(2,2-dimethylpentan-3-yl)-3-methoxy-2-methylbenzohydrazide (PubChem CID 174925580) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N-(2,2-dimethylpentan-3-yl)-3-methoxy-2-methylbenzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N-(2,2-dimethylpentan-3-yl)-3-methoxy-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 174925580 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N-(2,2-dimethylpentan-3-yl)-3-methoxy-2-methylbenzohydrazide |
| SMILES | CCC(N(NC(=O)c1cc(C)cc(C)c1)C(=O)c1cccc(OC)c1C)C(C)(C)C |
| InChI | InChI=1S/C25H34N2O3/c1-9-22(25(5,6)7)27(24(29)20-11-10-12-21(30-8)18(20)4)26-23(28)19-14-16(2)13-17(3)15-19/h10-15,22H,9H2,1-8H3,(H,26,28) |
| InChIKey | ATIAEHXBYQGWII-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|