About N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide
N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide (PubChem CID 11771754) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide |
| PubChem CID | 11771754 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide |
| SMILES | COc1cccc(C(=O)NN(C)C(=O)c2cc(C)cc(C)c2)c1C |
| InChI | InChI=1S/C19H22N2O3/c1-12-9-13(2)11-15(10-12)19(23)21(4)20-18(22)16-7-6-8-17(24-5)14(16)3/h6-11H,1-5H3,(H,20,22) |
| InChIKey | WXDDNHNGYQMETB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide?
The IUPAC name of N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide (CID 11771754) is N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide.
What is the SMILES notation for N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide?
The canonical SMILES for N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide is COc1cccc(C(=O)NN(C)C(=O)c2cc(C)cc(C)c2)c1C.
What is the InChIKey of N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide?
The InChIKey is WXDDNHNGYQMETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-12-9-13(2)11-15(10-12)19(23)21(4)20-18(22)16-7-6-8-17(24-5)14(16)3/h6-11H,1-5H3,(H,20,22).
What are the key properties of N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide?
N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide has a molecular weight of 326.40 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-dimethylbenzoyl)-3-methoxy-N',2-dimethylbenzohydrazide is sourced from PubChem (CID 11771754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).